About 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide
3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide (PubChem CID 43657710) has the molecular formula C17H17FN2S
and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide.
Molecular Properties
| Compound Name | 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide |
| PubChem CID | 43657710 |
| Molecular Formula | C17H17FN2S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide |
| SMILES | CC1CCc2ccccc2N1c1ccc(C(N)=S)cc1F |
| InChI | InChI=1S/C17H17FN2S/c1-11-6-7-12-4-2-3-5-15(12)20(11)16-9-8-13(17(19)21)10-14(16)18/h2-5,8-11H,6-7H2,1H3,(H2,19,21) |
| InChIKey | GONWWJZTZIATOM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
The IUPAC name of 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide (CID 43657710) is 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide.
What is the SMILES notation for 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
The canonical SMILES for 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide is CC1CCc2ccccc2N1c1ccc(C(N)=S)cc1F.
What is the InChIKey of 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
The InChIKey is GONWWJZTZIATOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2S/c1-11-6-7-12-4-2-3-5-15(12)20(11)16-9-8-13(17(19)21)10-14(16)18/h2-5,8-11H,6-7H2,1H3,(H2,19,21).
What are the key properties of 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide?
3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide has a molecular weight of 300.40 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(2-methyl-3,4-dihydro-2H-quinolin-1-yl)benzenecarbothioamide is sourced from PubChem (CID 43657710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).