About 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide
4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 43658478) has the molecular formula C13H9Cl2FN2OS
and a molecular weight of 331.20 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 43658478 |
| Molecular Formula | C13H9Cl2FN2OS |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(Sc2cc(Cl)ccc2Cl)c(F)c1 |
| InChI | InChI=1S/C13H9Cl2FN2OS/c14-8-2-3-9(15)12(6-8)20-11-4-1-7(5-10(11)16)13(17)18-19/h1-6,19H,(H2,17,18) |
| InChIKey | DATCDGZTNSTAJE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide (CID 43658478) is 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide is N/C(=N\O)c1ccc(Sc2cc(Cl)ccc2Cl)c(F)c1.
What is the InChIKey of 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide?
The InChIKey is DATCDGZTNSTAJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2FN2OS/c14-8-2-3-9(15)12(6-8)20-11-4-1-7(5-10(11)16)13(17)18-19/h1-6,19H,(H2,17,18).
What are the key properties of 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide?
4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide has a molecular weight of 331.20 g/mol, XLogP of 4.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorophenyl)sulfanyl-3-fluoro-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 43658478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).