About 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide
3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide (PubChem CID 43658502) has the molecular formula C10H10FN5OS
and a molecular weight of 267.29 g/mol. Its IUPAC name is 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide.
Molecular Properties
| Compound Name | 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
| PubChem CID | 43658502 |
| Molecular Formula | C10H10FN5OS |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide |
| SMILES | Cn1cnnc1Sc1ccc(/C(N)=N/O)cc1F |
| InChI | InChI=1S/C10H10FN5OS/c1-16-5-13-14-10(16)18-8-3-2-6(4-7(8)11)9(12)15-17/h2-5,17H,1H3,(H2,12,15) |
| InChIKey | FFPFZVLENXFNCC-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide?
The IUPAC name of 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide (CID 43658502) is 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide.
What is the SMILES notation for 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide?
The canonical SMILES for 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide is Cn1cnnc1Sc1ccc(/C(N)=N/O)cc1F.
What is the InChIKey of 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide?
The InChIKey is FFPFZVLENXFNCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN5OS/c1-16-5-13-14-10(16)18-8-3-2-6(4-7(8)11)9(12)15-17/h2-5,17H,1H3,(H2,12,15).
What are the key properties of 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide?
3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide has a molecular weight of 267.29 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N'-hydroxy-4-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]benzenecarboximidamide is sourced from PubChem (CID 43658502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).