About 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide
2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide (PubChem CID 43658894) has the molecular formula C15H14F2N2O2
and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide.
Molecular Properties
| Compound Name | 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide |
| PubChem CID | 43658894 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide |
| SMILES | N/C(Cc1ccc(OCc2cccc(F)c2F)cc1)=N\O |
| InChI | InChI=1S/C15H14F2N2O2/c16-13-3-1-2-11(15(13)17)9-21-12-6-4-10(5-7-12)8-14(18)19-20/h1-7,20H,8-9H2,(H2,18,19) |
| InChIKey | GGUXYYNCXLIKJB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide?
The IUPAC name of 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide (CID 43658894) is 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide.
What is the SMILES notation for 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide?
The canonical SMILES for 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide is N/C(Cc1ccc(OCc2cccc(F)c2F)cc1)=N\O.
What is the InChIKey of 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide?
The InChIKey is GGUXYYNCXLIKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F2N2O2/c16-13-3-1-2-11(15(13)17)9-21-12-6-4-10(5-7-12)8-14(18)19-20/h1-7,20H,8-9H2,(H2,18,19).
What are the key properties of 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide?
2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide has a molecular weight of 292.29 g/mol, XLogP of 2.83, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2,3-difluorophenyl)methoxy]phenyl]-N'-hydroxyethanimidamide is sourced from PubChem (CID 43658894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).