C16H14Cl2N2S — CID 43659967
3-[1-(2,4-dichlorophenyl)ethyl]-6-methyl-1H-benzimidazole-2-thione (PubChem CID 43659967) has the molecular formula C16H14Cl2N2S and a molecular weight of 337.28 g/mol. Its IUPAC name is 3-[1-(2,4-dichlorophenyl)ethyl]-6-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-[1-(2,4-dichlorophenyl)ethyl]-6-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 43659967 |
| Molecular Formula | C16H14Cl2N2S |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 3-[1-(2,4-dichlorophenyl)ethyl]-6-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2c(c1)[nH]c(=S)n2C(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H14Cl2N2S/c1-9-3-6-15-14(7-9)19-16(21)20(15)10(2)12-5-4-11(17)8-13(12)18/h3-8,10H,1-2H3,(H,19,21) |
| InChIKey | HTQAXRYJTFHTTJ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|