C10H7ClF4N2 — CID 43660106
2-(chloromethyl)-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazole (PubChem CID 43660106) has the molecular formula C10H7ClF4N2 and a molecular weight of 266.62 g/mol. Its IUPAC name is 2-(chloromethyl)-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazole.
| Compound Name | 2-(chloromethyl)-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazole |
|---|---|
| PubChem CID | 43660106 |
| Molecular Formula | C10H7ClF4N2 |
| Molecular Weight | 266.62 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 2-(chloromethyl)-5-fluoro-1-(2,2,2-trifluoroethyl)benzimidazole |
| SMILES | Fc1ccc2c(c1)nc(CCl)n2CC(F)(F)F |
| InChI | InChI=1S/C10H7ClF4N2/c11-4-9-16-7-3-6(12)1-2-8(7)17(9)5-10(13,14)15/h1-3H,4-5H2 |
| InChIKey | XCPWCBDMWGVNBP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.62 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|