C14H11Cl2N3 — CID 43661916
1-(2,4-dichlorophenyl)-5-methylbenzimidazol-2-amine (PubChem CID 43661916) has the molecular formula C14H11Cl2N3 and a molecular weight of 292.17 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-methylbenzimidazol-2-amine.
| Compound Name | 1-(2,4-dichlorophenyl)-5-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 43661916 |
| Molecular Formula | C14H11Cl2N3 |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-methylbenzimidazol-2-amine |
| SMILES | Cc1ccc2c(c1)nc(N)n2-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H11Cl2N3/c1-8-2-4-13-11(6-8)18-14(17)19(13)12-5-3-9(15)7-10(12)16/h2-7H,1H3,(H2,17,18) |
| InChIKey | LRRFWJLBJZNSEQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |