About N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide
N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide (PubChem CID 43662793) has the molecular formula C10H18N2O4
and a molecular weight of 230.26 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide |
| PubChem CID | 43662793 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide |
| SMILES | CN(C(=O)C1COCCO1)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C10H18N2O4/c1-12(7-4-11-5-8(7)13)10(14)9-6-15-2-3-16-9/h7-9,11,13H,2-6H2,1H3/t7-,8-,9?/m1/s1 |
| InChIKey | WHRUUUUCAGZQRS-ZAZKALAHSA-N |
| XLogP | -1.81 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide?
The IUPAC name of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide (CID 43662793) is N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide is CN(C(=O)C1COCCO1)[C@@H]1CNC[C@H]1O.
What is the InChIKey of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide?
The InChIKey is WHRUUUUCAGZQRS-ZAZKALAHSA-N. The full InChI is InChI=1S/C10H18N2O4/c1-12(7-4-11-5-8(7)13)10(14)9-6-15-2-3-16-9/h7-9,11,13H,2-6H2,1H3/t7-,8-,9?/m1/s1.
What are the key properties of N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide?
N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide has a molecular weight of 230.26 g/mol, XLogP of -1.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R,4R)-4-hydroxypyrrolidin-3-yl]-N-methyl-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 43662793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).