About N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine
N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine (PubChem CID 43663847) has the molecular formula C13H18N4S
and a molecular weight of 262.38 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine |
| PubChem CID | 43663847 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine |
| SMILES | CN(CCCNCc1csnn1)c1ccccc1 |
| InChI | InChI=1S/C13H18N4S/c1-17(13-6-3-2-4-7-13)9-5-8-14-10-12-11-18-16-15-12/h2-4,6-7,11,14H,5,8-10H2,1H3 |
| InChIKey | OKSVGJFPLNFSLY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine?
The IUPAC name of N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine (CID 43663847) is N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine.
What is the SMILES notation for N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine?
The canonical SMILES for N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine is CN(CCCNCc1csnn1)c1ccccc1.
What is the InChIKey of N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine?
The InChIKey is OKSVGJFPLNFSLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4S/c1-17(13-6-3-2-4-7-13)9-5-8-14-10-12-11-18-16-15-12/h2-4,6-7,11,14H,5,8-10H2,1H3.
What are the key properties of N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine?
N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine has a molecular weight of 262.38 g/mol, XLogP of 2.15, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N'-phenyl-N-(thiadiazol-4-ylmethyl)propane-1,3-diamine is sourced from PubChem (CID 43663847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).