About 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine
1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine (PubChem CID 43663889) has the molecular formula C12H24N4S
and a molecular weight of 256.42 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine |
| PubChem CID | 43663889 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine |
| SMILES | CCN(CC)CCCC(C)NCc1csnn1 |
| InChI | InChI=1S/C12H24N4S/c1-4-16(5-2)8-6-7-11(3)13-9-12-10-17-15-14-12/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | VSMSAKLYOJMPSH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine?
The IUPAC name of 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine (CID 43663889) is 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine.
What is the SMILES notation for 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine?
The canonical SMILES for 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine is CCN(CC)CCCC(C)NCc1csnn1.
What is the InChIKey of 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine?
The InChIKey is VSMSAKLYOJMPSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4S/c1-4-16(5-2)8-6-7-11(3)13-9-12-10-17-15-14-12/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine?
1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine has a molecular weight of 256.42 g/mol, XLogP of 2.14, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,1-N-diethyl-4-N-(thiadiazol-4-ylmethyl)pentane-1,4-diamine is sourced from PubChem (CID 43663889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).