About 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine
3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine (PubChem CID 43664084) has the molecular formula C12H24N4S
and a molecular weight of 256.42 g/mol. Its IUPAC name is 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine.
Molecular Properties
| Compound Name | 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine |
| PubChem CID | 43664084 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine |
| SMILES | CCC(CC)C(CNCc1csnn1)N(C)C |
| InChI | InChI=1S/C12H24N4S/c1-5-10(6-2)12(16(3)4)8-13-7-11-9-17-15-14-11/h9-10,12-13H,5-8H2,1-4H3 |
| InChIKey | FZUIWSBGXUODAY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine?
The IUPAC name of 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine (CID 43664084) is 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine.
What is the SMILES notation for 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine?
The canonical SMILES for 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine is CCC(CC)C(CNCc1csnn1)N(C)C.
What is the InChIKey of 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine?
The InChIKey is FZUIWSBGXUODAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N4S/c1-5-10(6-2)12(16(3)4)8-13-7-11-9-17-15-14-11/h9-10,12-13H,5-8H2,1-4H3.
What are the key properties of 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine?
3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine has a molecular weight of 256.42 g/mol, XLogP of 1.99, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-N,2-N-dimethyl-1-N-(thiadiazol-4-ylmethyl)pentane-1,2-diamine is sourced from PubChem (CID 43664084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).