C9H7F2N3S — CID 43664102
2,6-difluoro-N-(thiadiazol-4-ylmethyl)aniline (PubChem CID 43664102) has the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. Its IUPAC name is 2,6-difluoro-N-(thiadiazol-4-ylmethyl)aniline.
| Compound Name | 2,6-difluoro-N-(thiadiazol-4-ylmethyl)aniline |
|---|---|
| PubChem CID | 43664102 |
| Molecular Formula | C9H7F2N3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2,6-difluoro-N-(thiadiazol-4-ylmethyl)aniline |
| SMILES | Fc1cccc(F)c1NCc1csnn1 |
| InChI | InChI=1S/C9H7F2N3S/c10-7-2-1-3-8(11)9(7)12-4-6-5-15-14-13-6/h1-3,5,12H,4H2 |
| InChIKey | JWVWZXPSXUWRBM-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |