C7H12N4OS — CID 43664133
N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)acetamide (PubChem CID 43664133) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)acetamide.
| Compound Name | N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 43664133 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | N,N-dimethyl-2-(thiadiazol-4-ylmethylamino)acetamide |
| SMILES | CN(C)C(=O)CNCc1csnn1 |
| InChI | InChI=1S/C7H12N4OS/c1-11(2)7(12)4-8-3-6-5-13-10-9-6/h5,8H,3-4H2,1-2H3 |
| InChIKey | WCYAKSSZHNXTRE-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |