C15H21N3O2S — CID 43665074
5-[(4-ethoxyanilino)methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine (PubChem CID 43665074) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 5-[(4-ethoxyanilino)methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine.
| Compound Name | 5-[(4-ethoxyanilino)methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 43665074 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-[(4-ethoxyanilino)methyl]-4-methoxy-N,N-dimethyl-1,3-thiazol-2-amine |
| SMILES | CCOc1ccc(NCc2sc(N(C)C)nc2OC)cc1 |
| InChI | InChI=1S/C15H21N3O2S/c1-5-20-12-8-6-11(7-9-12)16-10-13-14(19-4)17-15(21-13)18(2)3/h6-9,16H,5,10H2,1-4H3 |
| InChIKey | ACSMWVGBVSXNMW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|