C13H26N4OS — CID 43665107
N-[[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 43665107) has the molecular formula C13H26N4OS and a molecular weight of 286.44 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 43665107 |
| Molecular Formula | C13H26N4OS |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | N-[[2-(dimethylamino)-4-methoxy-1,3-thiazol-5-yl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1sc(N(C)C)nc1OC |
| InChI | InChI=1S/C13H26N4OS/c1-6-17(7-2)9-8-14-10-11-12(18-5)15-13(19-11)16(3)4/h14H,6-10H2,1-5H3 |
| InChIKey | MYRWAORKXWQLGD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|