About 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine
4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine (PubChem CID 43665166) has the molecular formula C13H24N4OS
and a molecular weight of 284.43 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 43665166 |
| Molecular Formula | C13H24N4OS |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine |
| SMILES | COc1nc(N(C)C)sc1CNCCN1CCCC1 |
| InChI | InChI=1S/C13H24N4OS/c1-16(2)13-15-12(18-3)11(19-13)10-14-6-9-17-7-4-5-8-17/h14H,4-10H2,1-3H3 |
| InChIKey | SQOABKBUJCQJJK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine (CID 43665166) is 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine is COc1nc(N(C)C)sc1CNCCN1CCCC1.
What is the InChIKey of 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine?
The InChIKey is SQOABKBUJCQJJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4OS/c1-16(2)13-15-12(18-3)11(19-13)10-14-6-9-17-7-4-5-8-17/h14H,4-10H2,1-3H3.
What are the key properties of 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine?
4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine has a molecular weight of 284.43 g/mol, XLogP of 1.40, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,N-dimethyl-5-[(2-pyrrolidin-1-ylethylamino)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 43665166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).