C11H13FN2O3 — CID 43665877
methyl 3-[(5-amino-2-fluorobenzoyl)amino]propanoate (PubChem CID 43665877) has the molecular formula C11H13FN2O3 and a molecular weight of 240.23 g/mol. Its IUPAC name is methyl 3-[(5-amino-2-fluorobenzoyl)amino]propanoate.
| Compound Name | methyl 3-[(5-amino-2-fluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 43665877 |
| Molecular Formula | C11H13FN2O3 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl 3-[(5-amino-2-fluorobenzoyl)amino]propanoate |
| SMILES | COC(=O)CCNC(=O)c1cc(N)ccc1F |
| InChI | InChI=1S/C11H13FN2O3/c1-17-10(15)4-5-14-11(16)8-6-7(13)2-3-9(8)12/h2-3,6H,4-5,13H2,1H3,(H,14,16) |
| InChIKey | HJKRBDFYTICSOV-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|