C11H16N2O5S — CID 43665935
methyl 3-[(3-amino-4-methoxyphenyl)sulfonylamino]propanoate (PubChem CID 43665935) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is methyl 3-[(3-amino-4-methoxyphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[(3-amino-4-methoxyphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 43665935 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | methyl 3-[(3-amino-4-methoxyphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)CCNS(=O)(=O)c1ccc(OC)c(N)c1 |
| InChI | InChI=1S/C11H16N2O5S/c1-17-10-4-3-8(7-9(10)12)19(15,16)13-6-5-11(14)18-2/h3-4,7,13H,5-6,12H2,1-2H3 |
| InChIKey | NROMGAPMARGLGN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|