C15H10BrCl3N2 — CID 43667186
5-bromo-2-(1-chloroethyl)-1-(2,3-dichlorophenyl)benzimidazole (PubChem CID 43667186) has the molecular formula C15H10BrCl3N2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 5-bromo-2-(1-chloroethyl)-1-(2,3-dichlorophenyl)benzimidazole.
| Compound Name | 5-bromo-2-(1-chloroethyl)-1-(2,3-dichlorophenyl)benzimidazole |
|---|---|
| PubChem CID | 43667186 |
| Molecular Formula | C15H10BrCl3N2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 401.91 |
| IUPAC Name | 5-bromo-2-(1-chloroethyl)-1-(2,3-dichlorophenyl)benzimidazole |
| SMILES | CC(Cl)c1nc2cc(Br)ccc2n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H10BrCl3N2/c1-8(17)15-20-11-7-9(16)5-6-12(11)21(15)13-4-2-3-10(18)14(13)19/h2-8H,1H3 |
| InChIKey | NIJDYNVDWVFIFS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|