About 2-bromoimidazo[2,1-b][1,3,4]thiadiazole
2-bromoimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 43667923) has the molecular formula C4H2BrN3S
and a molecular weight of 204.05 g/mol. Its IUPAC name is 2-bromoimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-bromoimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 43667923 |
| Molecular Formula | C4H2BrN3S |
| Molecular Weight | 204.05 g/mol |
| Exact Mass | 202.92 |
| IUPAC Name | 2-bromoimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Brc1nn2ccnc2s1 |
| InChI | InChI=1S/C4H2BrN3S/c5-3-7-8-2-1-6-4(8)9-3/h1-2H |
| InChIKey | JFHCFWOCRFEOAG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.05 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-bromoimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole (CID 43667923) is 2-bromoimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole is Brc1nn2ccnc2s1.
What is the InChIKey of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is JFHCFWOCRFEOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2BrN3S/c5-3-7-8-2-1-6-4(8)9-3/h1-2H.
What are the key properties of 2-bromoimidazo[2,1-b][1,3,4]thiadiazole?
2-bromoimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 204.05 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 43667923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).