2-(2-oxo-1,3-thiazol-3-yl)acetic acid

C5H5NO3S — CID 43667924

IUPAC2-(2-oxo-1,3-thiazol-3-yl)acetic acid
SMILESO=C(O)Cn1ccsc1=O
InChIInChI=1S/C5H5NO3S/c7-4(8)3-6-1-2-10-5(6)9/h1-2H,3H2,(H,7,8)
InChIKeyZWEZHLGXYRWQKT-UHFFFAOYSA-N
MW159.17 g/mol
LogP-0.01
Rot. Bonds2

About 2-(2-oxo-1,3-thiazol-3-yl)acetic acid

2-(2-oxo-1,3-thiazol-3-yl)acetic acid (PubChem CID 43667924) has the molecular formula C5H5NO3S and a molecular weight of 159.17 g/mol. Its IUPAC name is 2-(2-oxo-1,3-thiazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(2-oxo-1,3-thiazol-3-yl)acetic acid
PubChem CID43667924
Molecular FormulaC5H5NO3S
Molecular Weight159.17 g/mol
Exact Mass159.00
IUPAC Name2-(2-oxo-1,3-thiazol-3-yl)acetic acid
SMILESO=C(O)Cn1ccsc1=O
InChIInChI=1S/C5H5NO3S/c7-4(8)3-6-1-2-10-5(6)9/h1-2H,3H2,(H,7,8)
InChIKeyZWEZHLGXYRWQKT-UHFFFAOYSA-N
XLogP-0.01
TPSA59.30 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.17
LogP ≤ 5-0.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2-oxo-1,3-thiazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-oxo-1,3-thiazol-3-yl)acetic acid?
The IUPAC name of 2-(2-oxo-1,3-thiazol-3-yl)acetic acid (CID 43667924) is 2-(2-oxo-1,3-thiazol-3-yl)acetic acid.
What is the SMILES notation for 2-(2-oxo-1,3-thiazol-3-yl)acetic acid?
The canonical SMILES for 2-(2-oxo-1,3-thiazol-3-yl)acetic acid is O=C(O)Cn1ccsc1=O.
What is the InChIKey of 2-(2-oxo-1,3-thiazol-3-yl)acetic acid?
The InChIKey is ZWEZHLGXYRWQKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3S/c7-4(8)3-6-1-2-10-5(6)9/h1-2H,3H2,(H,7,8).
What are the key properties of 2-(2-oxo-1,3-thiazol-3-yl)acetic acid?
2-(2-oxo-1,3-thiazol-3-yl)acetic acid has a molecular weight of 159.17 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxo-1,3-thiazol-3-yl)acetic acid is sourced from PubChem (CID 43667924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).