C16H19NO — CID 43668142
2-propyl-7,8,9,10-tetrahydro-1H-benzo[h]quinolin-4-one (PubChem CID 43668142) has the molecular formula C16H19NO and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-propyl-7,8,9,10-tetrahydro-1H-benzo[h]quinolin-4-one.
| Compound Name | 2-propyl-7,8,9,10-tetrahydro-1H-benzo[h]quinolin-4-one |
|---|---|
| PubChem CID | 43668142 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-propyl-7,8,9,10-tetrahydro-1H-benzo[h]quinolin-4-one |
| SMILES | CCCc1cc(=O)c2ccc3c(c2[nH]1)CCCC3 |
| InChI | InChI=1S/C16H19NO/c1-2-5-12-10-15(18)14-9-8-11-6-3-4-7-13(11)16(14)17-12/h8-10H,2-7H2,1H3,(H,17,18) |
| InChIKey | CBNJZNDUYCUNQN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |