About 4-chloro-2-ethyl-6,8-dimethylquinoline
4-chloro-2-ethyl-6,8-dimethylquinoline (PubChem CID 43668504) has the molecular formula C13H14ClN
and a molecular weight of 219.71 g/mol. Its IUPAC name is 4-chloro-2-ethyl-6,8-dimethylquinoline.
Molecular Properties
| Compound Name | 4-chloro-2-ethyl-6,8-dimethylquinoline |
| PubChem CID | 43668504 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.71 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-chloro-2-ethyl-6,8-dimethylquinoline |
| SMILES | CCc1cc(Cl)c2cc(C)cc(C)c2n1 |
| InChI | InChI=1S/C13H14ClN/c1-4-10-7-12(14)11-6-8(2)5-9(3)13(11)15-10/h5-7H,4H2,1-3H3 |
| InChIKey | IEAWCQMSUIBMLV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2-ethyl-6,8-dimethylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-ethyl-6,8-dimethylquinoline?
The IUPAC name of 4-chloro-2-ethyl-6,8-dimethylquinoline (CID 43668504) is 4-chloro-2-ethyl-6,8-dimethylquinoline.
What is the SMILES notation for 4-chloro-2-ethyl-6,8-dimethylquinoline?
The canonical SMILES for 4-chloro-2-ethyl-6,8-dimethylquinoline is CCc1cc(Cl)c2cc(C)cc(C)c2n1.
What is the InChIKey of 4-chloro-2-ethyl-6,8-dimethylquinoline?
The InChIKey is IEAWCQMSUIBMLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN/c1-4-10-7-12(14)11-6-8(2)5-9(3)13(11)15-10/h5-7H,4H2,1-3H3.
What are the key properties of 4-chloro-2-ethyl-6,8-dimethylquinoline?
4-chloro-2-ethyl-6,8-dimethylquinoline has a molecular weight of 219.71 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-ethyl-6,8-dimethylquinoline is sourced from PubChem (CID 43668504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).