C13H15N3O3 — CID 43669918
N'-hydroxy-4-(3-hydroxypropoxy)quinoline-3-carboximidamide (PubChem CID 43669918) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N'-hydroxy-4-(3-hydroxypropoxy)quinoline-3-carboximidamide.
| Compound Name | N'-hydroxy-4-(3-hydroxypropoxy)quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 43669918 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N'-hydroxy-4-(3-hydroxypropoxy)quinoline-3-carboximidamide |
| SMILES | N/C(=N\O)c1cnc2ccccc2c1OCCCO |
| InChI | InChI=1S/C13H15N3O3/c14-13(16-18)10-8-15-11-5-2-1-4-9(11)12(10)19-7-3-6-17/h1-2,4-5,8,17-18H,3,6-7H2,(H2,14,16) |
| InChIKey | ZMYKNULQJQLWDI-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 100.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|