C12H12Cl2N2S — CID 43670029
2,4-dichloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline (PubChem CID 43670029) has the molecular formula C12H12Cl2N2S and a molecular weight of 287.22 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline.
| Compound Name | 2,4-dichloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 43670029 |
| Molecular Formula | C12H12Cl2N2S |
| Molecular Weight | 287.22 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2,4-dichloro-N-[1-(2-methyl-1,3-thiazol-4-yl)ethyl]aniline |
| SMILES | Cc1nc(C(C)Nc2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C12H12Cl2N2S/c1-7(12-6-17-8(2)16-12)15-11-4-3-9(13)5-10(11)14/h3-7,15H,1-2H3 |
| InChIKey | AMXLRMKFIXQCOG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.22 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |