C11H11Cl2N3 — CID 43670697
5-(2,3-dichlorophenyl)-4-ethyl-1H-pyrazol-3-amine (PubChem CID 43670697) has the molecular formula C11H11Cl2N3 and a molecular weight of 256.14 g/mol. Its IUPAC name is 5-(2,3-dichlorophenyl)-4-ethyl-1H-pyrazol-3-amine.
| Compound Name | 5-(2,3-dichlorophenyl)-4-ethyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 43670697 |
| Molecular Formula | C11H11Cl2N3 |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 5-(2,3-dichlorophenyl)-4-ethyl-1H-pyrazol-3-amine |
| SMILES | CCc1c(N)n[nH]c1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C11H11Cl2N3/c1-2-6-10(15-16-11(6)14)7-4-3-5-8(12)9(7)13/h3-5H,2H2,1H3,(H3,14,15,16) |
| InChIKey | HIBTWSJEPSPBPV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |