C17H29NS — CID 43673911
2-tert-butyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclohexan-1-amine (PubChem CID 43673911) has the molecular formula C17H29NS and a molecular weight of 279.49 g/mol. Its IUPAC name is 2-tert-butyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclohexan-1-amine.
| Compound Name | 2-tert-butyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 43673911 |
| Molecular Formula | C17H29NS |
| Molecular Weight | 279.49 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 2-tert-butyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclohexan-1-amine |
| SMILES | Cc1ccc(C(C)NC2CCCCC2C(C)(C)C)s1 |
| InChI | InChI=1S/C17H29NS/c1-12-10-11-16(19-12)13(2)18-15-9-7-6-8-14(15)17(3,4)5/h10-11,13-15,18H,6-9H2,1-5H3 |
| InChIKey | WZTHKCPTRYTCNR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |