C12H14ClN3S — CID 43674087
1-(3-chlorophenyl)-N-(thiadiazol-4-ylmethyl)propan-1-amine (PubChem CID 43674087) has the molecular formula C12H14ClN3S and a molecular weight of 267.78 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-(thiadiazol-4-ylmethyl)propan-1-amine.
| Compound Name | 1-(3-chlorophenyl)-N-(thiadiazol-4-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 43674087 |
| Molecular Formula | C12H14ClN3S |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 1-(3-chlorophenyl)-N-(thiadiazol-4-ylmethyl)propan-1-amine |
| SMILES | CCC(NCc1csnn1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H14ClN3S/c1-2-12(9-4-3-5-10(13)6-9)14-7-11-8-17-16-15-11/h3-6,8,12,14H,2,7H2,1H3 |
| InChIKey | HGCWXGCHYPGSQC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |