C18H26N2 — CID 43674341
2-[4-(cyclooctylamino)phenyl]-2-methylpropanenitrile (PubChem CID 43674341) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-[4-(cyclooctylamino)phenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-(cyclooctylamino)phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 43674341 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-[4-(cyclooctylamino)phenyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1ccc(NC2CCCCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2/c1-18(2,14-19)15-10-12-17(13-11-15)20-16-8-6-4-3-5-7-9-16/h10-13,16,20H,3-9H2,1-2H3 |
| InChIKey | LMLAURWKKWDKDP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |