About 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine
5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine (PubChem CID 43674749) has the molecular formula C14H9ClF2N2S
and a molecular weight of 310.76 g/mol. Its IUPAC name is 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine |
| PubChem CID | 43674749 |
| Molecular Formula | C14H9ClF2N2S |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine |
| SMILES | Fc1cccc(F)c1CNc1c(Cl)ccc2scnc12 |
| InChI | InChI=1S/C14H9ClF2N2S/c15-9-4-5-12-14(19-7-20-12)13(9)18-6-8-10(16)2-1-3-11(8)17/h1-5,7,18H,6H2 |
| InChIKey | POLUXPMBDQMLLK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine?
The IUPAC name of 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine (CID 43674749) is 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine.
What is the SMILES notation for 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine?
The canonical SMILES for 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine is Fc1cccc(F)c1CNc1c(Cl)ccc2scnc12.
What is the InChIKey of 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine?
The InChIKey is POLUXPMBDQMLLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClF2N2S/c15-9-4-5-12-14(19-7-20-12)13(9)18-6-8-10(16)2-1-3-11(8)17/h1-5,7,18H,6H2.
What are the key properties of 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine?
5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine has a molecular weight of 310.76 g/mol, XLogP of 4.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(2,6-difluorophenyl)methyl]-1,3-benzothiazol-4-amine is sourced from PubChem (CID 43674749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).