About 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine
5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine (PubChem CID 43674881) has the molecular formula C13H13ClN4S
and a molecular weight of 292.79 g/mol. Its IUPAC name is 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine |
| PubChem CID | 43674881 |
| Molecular Formula | C13H13ClN4S |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine |
| SMILES | Cc1n[nH]c(C)c1CNc1c(Cl)ccc2scnc12 |
| InChI | InChI=1S/C13H13ClN4S/c1-7-9(8(2)18-17-7)5-15-12-10(14)3-4-11-13(12)16-6-19-11/h3-4,6,15H,5H2,1-2H3,(H,17,18) |
| InChIKey | MITLRSJGUNEXKE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine?
The IUPAC name of 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine (CID 43674881) is 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine.
What is the SMILES notation for 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine?
The canonical SMILES for 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine is Cc1n[nH]c(C)c1CNc1c(Cl)ccc2scnc12.
What is the InChIKey of 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine?
The InChIKey is MITLRSJGUNEXKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN4S/c1-7-9(8(2)18-17-7)5-15-12-10(14)3-4-11-13(12)16-6-19-11/h3-4,6,15H,5H2,1-2H3,(H,17,18).
What are the key properties of 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine?
5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine has a molecular weight of 292.79 g/mol, XLogP of 3.90, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-1,3-benzothiazol-4-amine is sourced from PubChem (CID 43674881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).