About 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline
2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline (PubChem CID 43675535) has the molecular formula C13H13N5O
and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline |
| PubChem CID | 43675535 |
| Molecular Formula | C13H13N5O |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline |
| SMILES | Cc1nnc(-c2ccccc2NCc2ccn[nH]2)o1 |
| InChI | InChI=1S/C13H13N5O/c1-9-16-18-13(19-9)11-4-2-3-5-12(11)14-8-10-6-7-15-17-10/h2-7,14H,8H2,1H3,(H,15,17) |
| InChIKey | NXGZTMQARMCIQF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 79.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline?
The IUPAC name of 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline (CID 43675535) is 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline.
What is the SMILES notation for 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline?
The canonical SMILES for 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline is Cc1nnc(-c2ccccc2NCc2ccn[nH]2)o1.
What is the InChIKey of 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline?
The InChIKey is NXGZTMQARMCIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O/c1-9-16-18-13(19-9)11-4-2-3-5-12(11)14-8-10-6-7-15-17-10/h2-7,14H,8H2,1H3,(H,15,17).
What are the key properties of 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline?
2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline has a molecular weight of 255.28 g/mol, XLogP of 2.38, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methyl-1,3,4-oxadiazol-2-yl)-N-(1H-pyrazol-5-ylmethyl)aniline is sourced from PubChem (CID 43675535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).