C15H24N2O3 — CID 43675654
4-methoxy-2-[(1-morpholin-4-ylpropan-2-ylamino)methyl]phenol (PubChem CID 43675654) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-methoxy-2-[(1-morpholin-4-ylpropan-2-ylamino)methyl]phenol.
| Compound Name | 4-methoxy-2-[(1-morpholin-4-ylpropan-2-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 43675654 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 4-methoxy-2-[(1-morpholin-4-ylpropan-2-ylamino)methyl]phenol |
| SMILES | COc1ccc(O)c(CNC(C)CN2CCOCC2)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-12(11-17-5-7-20-8-6-17)16-10-13-9-14(19-2)3-4-15(13)18/h3-4,9,12,16,18H,5-8,10-11H2,1-2H3 |
| InChIKey | RDUPMSAWXOWDNH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|