About N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine
N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine (PubChem CID 43676340) has the molecular formula C13H17NO2
and a molecular weight of 219.28 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
| PubChem CID | 43676340 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine |
| SMILES | CC1(C)Oc2ccc(NCC3CC3)cc2O1 |
| InChI | InChI=1S/C13H17NO2/c1-13(2)15-11-6-5-10(7-12(11)16-13)14-8-9-3-4-9/h5-7,9,14H,3-4,8H2,1-2H3 |
| InChIKey | WRWZXQXDPPPYDE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine?
The IUPAC name of N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine (CID 43676340) is N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine.
What is the SMILES notation for N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine?
The canonical SMILES for N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine is CC1(C)Oc2ccc(NCC3CC3)cc2O1.
What is the InChIKey of N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine?
The InChIKey is WRWZXQXDPPPYDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2/c1-13(2)15-11-6-5-10(7-12(11)16-13)14-8-9-3-4-9/h5-7,9,14H,3-4,8H2,1-2H3.
What are the key properties of N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine?
N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine has a molecular weight of 219.28 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopropylmethyl)-2,2-dimethyl-1,3-benzodioxol-5-amine is sourced from PubChem (CID 43676340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).