C17H21N3O — CID 43676485
3-[1-[(2-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]phenol (PubChem CID 43676485) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 3-[1-[(2-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]phenol.
| Compound Name | 3-[1-[(2-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 43676485 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[1-[(2-pyrrolidin-1-yl-3-pyridinyl)amino]ethyl]phenol |
| SMILES | CC(Nc1cccnc1N1CCCC1)c1cccc(O)c1 |
| InChI | InChI=1S/C17H21N3O/c1-13(14-6-4-7-15(21)12-14)19-16-8-5-9-18-17(16)20-10-2-3-11-20/h4-9,12-13,19,21H,2-3,10-11H2,1H3 |
| InChIKey | MXVBIGIQCJQEHK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |