C17H19BrN2O — CID 43677290
N-[3-[(2-bromophenyl)methylamino]-4-methylphenyl]propanamide (PubChem CID 43677290) has the molecular formula C17H19BrN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is N-[3-[(2-bromophenyl)methylamino]-4-methylphenyl]propanamide.
| Compound Name | N-[3-[(2-bromophenyl)methylamino]-4-methylphenyl]propanamide |
|---|---|
| PubChem CID | 43677290 |
| Molecular Formula | C17H19BrN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | N-[3-[(2-bromophenyl)methylamino]-4-methylphenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C)c(NCc2ccccc2Br)c1 |
| InChI | InChI=1S/C17H19BrN2O/c1-3-17(21)20-14-9-8-12(2)16(10-14)19-11-13-6-4-5-7-15(13)18/h4-10,19H,3,11H2,1-2H3,(H,20,21) |
| InChIKey | XFIQTIIXKQZZNW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |