About 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine
3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine (PubChem CID 43678920) has the molecular formula C13H21N3O
and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine.
Molecular Properties
| Compound Name | 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine |
| PubChem CID | 43678920 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine |
| SMILES | COc1nccc(N(C)C)c1NC1CCCC1 |
| InChI | InChI=1S/C13H21N3O/c1-16(2)11-8-9-14-13(17-3)12(11)15-10-6-4-5-7-10/h8-10,15H,4-7H2,1-3H3 |
| InChIKey | FMHRTSYMWRSCRQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
The IUPAC name of 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine (CID 43678920) is 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine.
What is the SMILES notation for 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
The canonical SMILES for 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine is COc1nccc(N(C)C)c1NC1CCCC1.
What is the InChIKey of 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
The InChIKey is FMHRTSYMWRSCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O/c1-16(2)11-8-9-14-13(17-3)12(11)15-10-6-4-5-7-10/h8-10,15H,4-7H2,1-3H3.
What are the key properties of 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine?
3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine has a molecular weight of 235.33 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-cyclopentyl-2-methoxy-4-N,4-N-dimethylpyridine-3,4-diamine is sourced from PubChem (CID 43678920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).