C14H21NO4S — CID 43679743
2-ethoxy-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]phenol (PubChem CID 43679743) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is 2-ethoxy-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]phenol.
| Compound Name | 2-ethoxy-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 43679743 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-ethoxy-4-[[(3-methyl-1,1-dioxothiolan-3-yl)amino]methyl]phenol |
| SMILES | CCOc1cc(CNC2(C)CCS(=O)(=O)C2)ccc1O |
| InChI | InChI=1S/C14H21NO4S/c1-3-19-13-8-11(4-5-12(13)16)9-15-14(2)6-7-20(17,18)10-14/h4-5,8,15-16H,3,6-7,9-10H2,1-2H3 |
| InChIKey | JFRZABKRUSFXQU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |