C15H15Br2NO — CID 43682995
2-[1-(2,4-dibromoanilino)ethyl]-5-methylphenol (PubChem CID 43682995) has the molecular formula C15H15Br2NO and a molecular weight of 385.10 g/mol. Its IUPAC name is 2-[1-(2,4-dibromoanilino)ethyl]-5-methylphenol.
| Compound Name | 2-[1-(2,4-dibromoanilino)ethyl]-5-methylphenol |
|---|---|
| PubChem CID | 43682995 |
| Molecular Formula | C15H15Br2NO |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 2-[1-(2,4-dibromoanilino)ethyl]-5-methylphenol |
| SMILES | Cc1ccc(C(C)Nc2ccc(Br)cc2Br)c(O)c1 |
| InChI | InChI=1S/C15H15Br2NO/c1-9-3-5-12(15(19)7-9)10(2)18-14-6-4-11(16)8-13(14)17/h3-8,10,18-19H,1-2H3 |
| InChIKey | WIBAHOYCZDWWHA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|