C12H11Br2NS — CID 43683008
2,4-dibromo-N-[(5-methylthiophen-2-yl)methyl]aniline (PubChem CID 43683008) has the molecular formula C12H11Br2NS and a molecular weight of 361.10 g/mol. Its IUPAC name is 2,4-dibromo-N-[(5-methylthiophen-2-yl)methyl]aniline.
| Compound Name | 2,4-dibromo-N-[(5-methylthiophen-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 43683008 |
| Molecular Formula | C12H11Br2NS |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 358.90 |
| IUPAC Name | 2,4-dibromo-N-[(5-methylthiophen-2-yl)methyl]aniline |
| SMILES | Cc1ccc(CNc2ccc(Br)cc2Br)s1 |
| InChI | InChI=1S/C12H11Br2NS/c1-8-2-4-10(16-8)7-15-12-5-3-9(13)6-11(12)14/h2-6,15H,7H2,1H3 |
| InChIKey | WYVOMMYQZXZVTA-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |