C14H18Br2N2 — CID 43683153
N-(2,4-dibromophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 43683153) has the molecular formula C14H18Br2N2 and a molecular weight of 374.12 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | N-(2,4-dibromophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 43683153 |
| Molecular Formula | C14H18Br2N2 |
| Molecular Weight | 374.12 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | N-(2,4-dibromophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CN1C2CCC1CC(Nc1ccc(Br)cc1Br)C2 |
| InChI | InChI=1S/C14H18Br2N2/c1-18-11-3-4-12(18)8-10(7-11)17-14-5-2-9(15)6-13(14)16/h2,5-6,10-12,17H,3-4,7-8H2,1H3 |
| InChIKey | JLUJYOGZWZATDP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.12 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |