C14H22N2O — CID 43683753
N-[4-(butan-2-ylamino)phenyl]-2-methylpropanamide (PubChem CID 43683753) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N-[4-(butan-2-ylamino)phenyl]-2-methylpropanamide.
| Compound Name | N-[4-(butan-2-ylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 43683753 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N-[4-(butan-2-ylamino)phenyl]-2-methylpropanamide |
| SMILES | CCC(C)Nc1ccc(NC(=O)C(C)C)cc1 |
| InChI | InChI=1S/C14H22N2O/c1-5-11(4)15-12-6-8-13(9-7-12)16-14(17)10(2)3/h6-11,15H,5H2,1-4H3,(H,16,17) |
| InChIKey | RKYMGCQGHIJACO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |