C15H20N2O2 — CID 43684646
1-[5-(oxolan-3-ylmethylamino)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 43684646) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[5-(oxolan-3-ylmethylamino)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-(oxolan-3-ylmethylamino)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 43684646 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[5-(oxolan-3-ylmethylamino)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(NCC3CCOC3)ccc21 |
| InChI | InChI=1S/C15H20N2O2/c1-11(18)17-6-4-13-8-14(2-3-15(13)17)16-9-12-5-7-19-10-12/h2-3,8,12,16H,4-7,9-10H2,1H3 |
| InChIKey | BYWPRSFIGPGTBR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |