About N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline (PubChem CID 43685247) has the molecular formula C13H14FN3O2S
and a molecular weight of 295.34 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline.
Molecular Properties
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline |
| PubChem CID | 43685247 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline |
| SMILES | Cc1nc(C(C)Nc2ccc(F)cc2[N+](=O)[O-])c(C)s1 |
| InChI | InChI=1S/C13H14FN3O2S/c1-7(13-8(2)20-9(3)16-13)15-11-5-4-10(14)6-12(11)17(18)19/h4-7,15H,1-3H3 |
| InChIKey | RCKGKOWBKMPURC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline?
The IUPAC name of N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline (CID 43685247) is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline.
What is the SMILES notation for N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline?
The canonical SMILES for N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline is Cc1nc(C(C)Nc2ccc(F)cc2[N+](=O)[O-])c(C)s1.
What is the InChIKey of N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline?
The InChIKey is RCKGKOWBKMPURC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FN3O2S/c1-7(13-8(2)20-9(3)16-13)15-11-5-4-10(14)6-12(11)17(18)19/h4-7,15H,1-3H3.
What are the key properties of N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline?
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline has a molecular weight of 295.34 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-4-fluoro-2-nitroaniline is sourced from PubChem (CID 43685247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).