About 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine
6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine (PubChem CID 43685858) has the molecular formula C13H16ClNO2
and a molecular weight of 253.73 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine |
| PubChem CID | 43685858 |
| Molecular Formula | C13H16ClNO2 |
| Molecular Weight | 253.73 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine |
| SMILES | Clc1cc2c(cc1NC1CCCCC1)OCO2 |
| InChI | InChI=1S/C13H16ClNO2/c14-10-6-12-13(17-8-16-12)7-11(10)15-9-4-2-1-3-5-9/h6-7,9,15H,1-5,8H2 |
| InChIKey | ODGSAKTXXXUKIB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine?
The IUPAC name of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine (CID 43685858) is 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine.
What is the SMILES notation for 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine?
The canonical SMILES for 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine is Clc1cc2c(cc1NC1CCCCC1)OCO2.
What is the InChIKey of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine?
The InChIKey is ODGSAKTXXXUKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO2/c14-10-6-12-13(17-8-16-12)7-11(10)15-9-4-2-1-3-5-9/h6-7,9,15H,1-5,8H2.
What are the key properties of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine?
6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine has a molecular weight of 253.73 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine is sourced from PubChem (CID 43685858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).