About N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine
N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine (PubChem CID 43687819) has the molecular formula C16H13F2NS
and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine.
Molecular Properties
| Compound Name | N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine |
| PubChem CID | 43687819 |
| Molecular Formula | C16H13F2NS |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine |
| SMILES | CC(Nc1ccc2sccc2c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H13F2NS/c1-10(14-9-12(17)2-4-15(14)18)19-13-3-5-16-11(8-13)6-7-20-16/h2-10,19H,1H3 |
| InChIKey | YKKDKZWBBSNMEO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine?
The IUPAC name of N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine (CID 43687819) is N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine.
What is the SMILES notation for N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine?
The canonical SMILES for N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine is CC(Nc1ccc2sccc2c1)c1cc(F)ccc1F.
What is the InChIKey of N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine?
The InChIKey is YKKDKZWBBSNMEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F2NS/c1-10(14-9-12(17)2-4-15(14)18)19-13-3-5-16-11(8-13)6-7-20-16/h2-10,19H,1H3.
What are the key properties of N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine?
N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine has a molecular weight of 289.35 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,5-difluorophenyl)ethyl]-1-benzothiophen-5-amine is sourced from PubChem (CID 43687819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).