C14H14F2N2O2S — CID 43688489
3-[(2,6-difluorophenyl)methylamino]-N-methylbenzenesulfonamide (PubChem CID 43688489) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is 3-[(2,6-difluorophenyl)methylamino]-N-methylbenzenesulfonamide.
| Compound Name | 3-[(2,6-difluorophenyl)methylamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43688489 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-[(2,6-difluorophenyl)methylamino]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cccc(NCc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C14H14F2N2O2S/c1-17-21(19,20)11-5-2-4-10(8-11)18-9-12-13(15)6-3-7-14(12)16/h2-8,17-18H,9H2,1H3 |
| InChIKey | UGWDXCJXTNXWTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |