C12H18BrNO2S — CID 43689116
methyl 2-[(4-bromothiophen-2-yl)methylamino]-4-methylpentanoate (PubChem CID 43689116) has the molecular formula C12H18BrNO2S and a molecular weight of 320.25 g/mol. Its IUPAC name is methyl 2-[(4-bromothiophen-2-yl)methylamino]-4-methylpentanoate.
| Compound Name | methyl 2-[(4-bromothiophen-2-yl)methylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 43689116 |
| Molecular Formula | C12H18BrNO2S |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | methyl 2-[(4-bromothiophen-2-yl)methylamino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H18BrNO2S/c1-8(2)4-11(12(15)16-3)14-6-10-5-9(13)7-17-10/h5,7-8,11,14H,4,6H2,1-3H3 |
| InChIKey | JFJITGPHZGUBIE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |