C13H9BrClN3O — CID 43689978
4-bromo-3-[(2-chloro-3-pyridinyl)amino]-1,3-dihydroindol-2-one (PubChem CID 43689978) has the molecular formula C13H9BrClN3O and a molecular weight of 338.59 g/mol. Its IUPAC name is 4-bromo-3-[(2-chloro-3-pyridinyl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 4-bromo-3-[(2-chloro-3-pyridinyl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 43689978 |
| Molecular Formula | C13H9BrClN3O |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 4-bromo-3-[(2-chloro-3-pyridinyl)amino]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cccc(Br)c2C1Nc1cccnc1Cl |
| InChI | InChI=1S/C13H9BrClN3O/c14-7-3-1-4-8-10(7)11(13(19)18-8)17-9-5-2-6-16-12(9)15/h1-6,11,17H,(H,18,19) |
| InChIKey | WHWCODNWWWRMIX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|