C12H14F3NS2 — CID 43691344
N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]thiolan-3-amine (PubChem CID 43691344) has the molecular formula C12H14F3NS2 and a molecular weight of 293.38 g/mol. Its IUPAC name is N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]thiolan-3-amine.
| Compound Name | N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]thiolan-3-amine |
|---|---|
| PubChem CID | 43691344 |
| Molecular Formula | C12H14F3NS2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]thiolan-3-amine |
| SMILES | FC(F)(F)CSc1ccccc1NC1CCSC1 |
| InChI | InChI=1S/C12H14F3NS2/c13-12(14,15)8-18-11-4-2-1-3-10(11)16-9-5-6-17-7-9/h1-4,9,16H,5-8H2 |
| InChIKey | NKKLEDZCZLNMFE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |